C21H26N4O6S — CID 89175268
N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1H-indole-2-carboxamide (PubChem CID 89175268) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1H-indole-2-carboxamide.
| Compound Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 89175268 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[5-tert-butyl-3-(methanesulfonamido)-2-methoxyphenyl]-7-(dihydroxyamino)-1H-indole-2-carboxamide |
| SMILES | COc1c(NC(=O)c2cc3cccc(N(O)O)c3[nH]2)cc(C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C21H26N4O6S/c1-21(2,3)13-10-14(19(31-4)15(11-13)24-32(5,29)30)23-20(26)16-9-12-7-6-8-17(25(27)28)18(12)22-16/h6-11,22,24,27-28H,1-5H3,(H,23,26) |
| InChIKey | SZGBAYNYJIIHQB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|