C11H21NO — CID 89177702
1-(3,3-diethylpiperidin-1-yl)ethanone (PubChem CID 89177702) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 1-(3,3-diethylpiperidin-1-yl)ethanone.
| Compound Name | 1-(3,3-diethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 89177702 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 1-(3,3-diethylpiperidin-1-yl)ethanone |
| SMILES | CCC1(CC)CCCN(C(C)=O)C1 |
| InChI | InChI=1S/C11H21NO/c1-4-11(5-2)7-6-8-12(9-11)10(3)13/h4-9H2,1-3H3 |
| InChIKey | LXUSQIZTBZVEPB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |