C8H17N2O8P — CID 89177803
(2-amino-3-phosphonooxypropanoyl)oxymethyl 2-aminobutanoate (PubChem CID 89177803) has the molecular formula C8H17N2O8P and a molecular weight of 300.20 g/mol. Its IUPAC name is (2-amino-3-phosphonooxypropanoyl)oxymethyl 2-aminobutanoate.
| Compound Name | (2-amino-3-phosphonooxypropanoyl)oxymethyl 2-aminobutanoate |
|---|---|
| PubChem CID | 89177803 |
| Molecular Formula | C8H17N2O8P |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2-amino-3-phosphonooxypropanoyl)oxymethyl 2-aminobutanoate |
| SMILES | CCC(N)C(=O)OCOC(=O)C(N)COP(=O)(O)O |
| InChI | InChI=1S/C8H17N2O8P/c1-2-5(9)7(11)16-4-17-8(12)6(10)3-18-19(13,14)15/h5-6H,2-4,9-10H2,1H3,(H2,13,14,15) |
| InChIKey | QEITVERSMKVRTJ-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 171.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|