C26H27BrF6N4O — CID 89180504
(2S,5R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(bromomethyl)-5-methyl-2-phenyl-5-(1,2,4-triazol-4-yl)piperidine (PubChem CID 89180504) has the molecular formula C26H27BrF6N4O and a molecular weight of 605.42 g/mol. Its IUPAC name is (2S,5R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(bromomethyl)-5-methyl-2-phenyl-5-(1,2,4-triazol-4-yl)piperidine.
| Compound Name | (2S,5R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(bromomethyl)-5-methyl-2-phenyl-5-(1,2,4-triazol-4-yl)piperidine |
|---|---|
| PubChem CID | 89180504 |
| Molecular Formula | C26H27BrF6N4O |
| Molecular Weight | 605.42 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | (2S,5R)-2-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-1-(bromomethyl)-5-methyl-2-phenyl-5-(1,2,4-triazol-4-yl)piperidine |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CC[C@@](C)(n2cnnc2)CN1CBr)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H27BrF6N4O/c1-18(19-10-21(25(28,29)30)12-22(11-19)26(31,32)33)38-14-24(20-6-4-3-5-7-20)9-8-23(2,13-36(24)15-27)37-16-34-35-17-37/h3-7,10-12,16-18H,8-9,13-15H2,1-2H3/t18-,23-,24-/m1/s1 |
| InChIKey | PDWLVUVAVJTKCC-DQMJNTIXSA-N |
| XLogP | 7.15 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.42 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|