C20H27Cl2N5O3S — CID 89181470
(2Z,4E)-2-amino-5-[2-[[(2S)-4-[(3,4-dichlorocyclohexa-2,4-dien-1-yl)methyl]morpholin-2-yl]methylamino]-2-oxoethyl]sulfanyl-5-(methylideneamino)penta-2,4-dienamide (PubChem CID 89181470) has the molecular formula C20H27Cl2N5O3S and a molecular weight of 488.44 g/mol. Its IUPAC name is (2Z,4E)-2-amino-5-[2-[[(2S)-4-[(3,4-dichlorocyclohexa-2,4-dien-1-yl)methyl]morpholin-2-yl]methylamino]-2-oxoethyl]sulfanyl-5-(methylideneamino)penta-2,4-dienamide.
| Compound Name | (2Z,4E)-2-amino-5-[2-[[(2S)-4-[(3,4-dichlorocyclohexa-2,4-dien-1-yl)methyl]morpholin-2-yl]methylamino]-2-oxoethyl]sulfanyl-5-(methylideneamino)penta-2,4-dienamide |
|---|---|
| PubChem CID | 89181470 |
| Molecular Formula | C20H27Cl2N5O3S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | (2Z,4E)-2-amino-5-[2-[[(2S)-4-[(3,4-dichlorocyclohexa-2,4-dien-1-yl)methyl]morpholin-2-yl]methylamino]-2-oxoethyl]sulfanyl-5-(methylideneamino)penta-2,4-dienamide |
| SMILES | C=N/C(=C\C=C(/N)C(N)=O)SCC(=O)NC[C@H]1CN(CC2C=C(Cl)C(Cl)=CC2)CCO1 |
| InChI | InChI=1S/C20H27Cl2N5O3S/c1-25-19(5-4-17(23)20(24)29)31-12-18(28)26-9-14-11-27(6-7-30-14)10-13-2-3-15(21)16(22)8-13/h3-5,8,13-14H,1-2,6-7,9-12,23H2,(H2,24,29)(H,26,28)/b17-4-,19-5+/t13?,14-/m0/s1 |
| InChIKey | LWDLTHGKROWIFJ-PIPGQLEBSA-N |
| XLogP | 1.67 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|