C27H29NO5S2 — CID 89182095
(5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate (PubChem CID 89182095) has the molecular formula C27H29NO5S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is (5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate.
| Compound Name | (5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89182095 |
| Molecular Formula | C27H29NO5S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | (5-octylsulfanyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 4-methylbenzenesulfonate |
| SMILES | CCCCCCCCSc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)c1ccc(C)cc1)C2=O |
| InChI | InChI=1S/C27H29NO5S2/c1-3-4-5-6-7-8-16-34-21-17-20-10-9-11-23-25(20)24(18-21)27(30)28(26(23)29)33-35(31,32)22-14-12-19(2)13-15-22/h9-15,17-18H,3-8,16H2,1-2H3 |
| InChIKey | AHBKGSFWVWXVGK-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|