C24H51N — CID 89184947
(8S,9R,11R)-11-ethyl-8-methyl-9-pentylhexadecan-7-amine (PubChem CID 89184947) has the molecular formula C24H51N and a molecular weight of 353.68 g/mol. Its IUPAC name is (8S,9R,11R)-11-ethyl-8-methyl-9-pentylhexadecan-7-amine.
| Compound Name | (8S,9R,11R)-11-ethyl-8-methyl-9-pentylhexadecan-7-amine |
|---|---|
| PubChem CID | 89184947 |
| Molecular Formula | C24H51N |
| Molecular Weight | 353.68 g/mol |
| Exact Mass | 353.40 |
| IUPAC Name | (8S,9R,11R)-11-ethyl-8-methyl-9-pentylhexadecan-7-amine |
| SMILES | CCCCCCC(N)[C@@H](C)[C@H](CCCCC)C[C@H](CC)CCCCC |
| InChI | InChI=1S/C24H51N/c1-6-10-13-16-19-24(25)21(5)23(18-15-12-8-3)20-22(9-4)17-14-11-7-2/h21-24H,6-20,25H2,1-5H3/t21-,22+,23+,24?/m0/s1 |
| InChIKey | BBKNXXAGACROKM-DVZSQSHLSA-N |
| XLogP | 8.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.68 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|