About 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole
5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 89185724) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole.
Analyze 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole?
The IUPAC name of 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole (CID 89185724) is 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole?
The canonical SMILES for 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole is Cc1noc([C@H](C)C2CC2)n1.
What is the InChIKey of 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole?
The InChIKey is CKCGEMXRHOTCOI-RXMQYKEDSA-N. The full InChI is InChI=1S/C8H12N2O/c1-5(7-3-4-7)8-9-6(2)10-11-8/h5,7H,3-4H2,1-2H3/t5-/m1/s1.
What are the key properties of 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole?
5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole has a molecular weight of 152.20 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-1-cyclopropylethyl]-3-methyl-1,2,4-oxadiazole is sourced from PubChem (CID 89185724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).