methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate

C7H10N2O3 — CID 77230842

IUPACmethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate
SMILESCOC(=O)C(C)c1nc(C)no1
InChIInChI=1S/C7H10N2O3/c1-4(7(10)11-3)6-8-5(2)9-12-6/h4H,1-3H3
InChIKeyLEEHBDRDTUDETE-UHFFFAOYSA-N
MW170.17 g/mol
LogP0.65
Rot. Bonds2

About methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate

methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate (PubChem CID 77230842) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate
PubChem CID77230842
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Namemethyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate
SMILESCOC(=O)C(C)c1nc(C)no1
InChIInChI=1S/C7H10N2O3/c1-4(7(10)11-3)6-8-5(2)9-12-6/h4H,1-3H3
InChIKeyLEEHBDRDTUDETE-UHFFFAOYSA-N
XLogP0.65
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 50.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate?
The IUPAC name of methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate (CID 77230842) is methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate.
What is the SMILES notation for methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate?
The canonical SMILES for methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate is COC(=O)C(C)c1nc(C)no1.
What is the InChIKey of methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate?
The InChIKey is LEEHBDRDTUDETE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-4(7(10)11-3)6-8-5(2)9-12-6/h4H,1-3H3.
What are the key properties of methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate?
methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate has a molecular weight of 170.17 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-methyl-1,2,4-oxadiazol-5-yl)propanoate is sourced from PubChem (CID 77230842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).