About 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one
4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one (PubChem CID 63346626) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one.
Analyze 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one?
The IUPAC name of 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one (CID 63346626) is 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one.
What is the SMILES notation for 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one?
The canonical SMILES for 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one is CC(=O)C(c1nc(C)no1)C(C)C.
What is the InChIKey of 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one?
The InChIKey is YHHCTZWECGNVCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-5(2)8(6(3)12)9-10-7(4)11-13-9/h5,8H,1-4H3.
What are the key properties of 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one?
4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one has a molecular weight of 182.22 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-2-one is sourced from PubChem (CID 63346626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).