C11H18N2O2 — CID 63344414
4-methyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)pentan-2-one (PubChem CID 63344414) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-methyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)pentan-2-one.
| Compound Name | 4-methyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)pentan-2-one |
|---|---|
| PubChem CID | 63344414 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-methyl-3-(3-propyl-1,2,4-oxadiazol-5-yl)pentan-2-one |
| SMILES | CCCc1noc(C(C(C)=O)C(C)C)n1 |
| InChI | InChI=1S/C11H18N2O2/c1-5-6-9-12-11(15-13-9)10(7(2)3)8(4)14/h7,10H,5-6H2,1-4H3 |
| InChIKey | JBOKHFAVKBARMC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |