About [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate
[(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate (PubChem CID 91297096) has the molecular formula C10H17N3O3
and a molecular weight of 227.26 g/mol. Its IUPAC name is [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate |
| PubChem CID | 91297096 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate |
| SMILES | Cc1noc([C@@H](C)OC(=O)NC(C)(C)C)n1 |
| InChI | InChI=1S/C10H17N3O3/c1-6(8-11-7(2)13-16-8)15-9(14)12-10(3,4)5/h6H,1-5H3,(H,12,14)/t6-/m1/s1 |
| InChIKey | RZGGFFJOPQTQOI-ZCFIWIBFSA-N |
| XLogP | 1.96 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate?
The IUPAC name of [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate (CID 91297096) is [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate.
What is the SMILES notation for [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate?
The canonical SMILES for [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate is Cc1noc([C@@H](C)OC(=O)NC(C)(C)C)n1.
What is the InChIKey of [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate?
The InChIKey is RZGGFFJOPQTQOI-ZCFIWIBFSA-N. The full InChI is InChI=1S/C10H17N3O3/c1-6(8-11-7(2)13-16-8)15-9(14)12-10(3,4)5/h6H,1-5H3,(H,12,14)/t6-/m1/s1.
What are the key properties of [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate?
[(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate has a molecular weight of 227.26 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl] N-tert-butylcarbamate is sourced from PubChem (CID 91297096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).