About 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide
3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide (PubChem CID 131086378) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide.
Molecular Properties
| Compound Name | 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide |
| PubChem CID | 131086378 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide |
| SMILES | Cc1noc(C(N)CC(N)=O)n1 |
| InChI | InChI=1S/C6H10N4O2/c1-3-9-6(12-10-3)4(7)2-5(8)11/h4H,2,7H2,1H3,(H2,8,11) |
| InChIKey | HNARISDLKACRRN-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide?
The IUPAC name of 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide (CID 131086378) is 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide.
What is the SMILES notation for 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide?
The canonical SMILES for 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide is Cc1noc(C(N)CC(N)=O)n1.
What is the InChIKey of 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide?
The InChIKey is HNARISDLKACRRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c1-3-9-6(12-10-3)4(7)2-5(8)11/h4H,2,7H2,1H3,(H2,8,11).
What are the key properties of 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide?
3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide has a molecular weight of 170.17 g/mol, XLogP of -0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(3-methyl-1,2,4-oxadiazol-5-yl)propanamide is sourced from PubChem (CID 131086378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).