About methyl 2-(1,2-oxazol-5-yl)propanoate
methyl 2-(1,2-oxazol-5-yl)propanoate (PubChem CID 90936290) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is methyl 2-(1,2-oxazol-5-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2-(1,2-oxazol-5-yl)propanoate |
| PubChem CID | 90936290 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | methyl 2-(1,2-oxazol-5-yl)propanoate |
| SMILES | COC(=O)C(C)c1ccno1 |
| InChI | InChI=1S/C7H9NO3/c1-5(7(9)10-2)6-3-4-8-11-6/h3-5H,1-2H3 |
| InChIKey | MEKWDSZVOVJDFK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(1,2-oxazol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,2-oxazol-5-yl)propanoate?
The IUPAC name of methyl 2-(1,2-oxazol-5-yl)propanoate (CID 90936290) is methyl 2-(1,2-oxazol-5-yl)propanoate.
What is the SMILES notation for methyl 2-(1,2-oxazol-5-yl)propanoate?
The canonical SMILES for methyl 2-(1,2-oxazol-5-yl)propanoate is COC(=O)C(C)c1ccno1.
What is the InChIKey of methyl 2-(1,2-oxazol-5-yl)propanoate?
The InChIKey is MEKWDSZVOVJDFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-5(7(9)10-2)6-3-4-8-11-6/h3-5H,1-2H3.
What are the key properties of methyl 2-(1,2-oxazol-5-yl)propanoate?
methyl 2-(1,2-oxazol-5-yl)propanoate has a molecular weight of 155.15 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,2-oxazol-5-yl)propanoate is sourced from PubChem (CID 90936290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).