About 3-methylbutyl 1,2-oxazole-5-carboxylate
3-methylbutyl 1,2-oxazole-5-carboxylate (PubChem CID 164887837) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-methylbutyl 1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutyl 1,2-oxazole-5-carboxylate |
| PubChem CID | 164887837 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3-methylbutyl 1,2-oxazole-5-carboxylate |
| SMILES | CC(C)CCOC(=O)c1ccno1 |
| InChI | InChI=1S/C9H13NO3/c1-7(2)4-6-12-9(11)8-3-5-10-13-8/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | IDSSPOOKUDFSSH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylbutyl 1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 1,2-oxazole-5-carboxylate?
The IUPAC name of 3-methylbutyl 1,2-oxazole-5-carboxylate (CID 164887837) is 3-methylbutyl 1,2-oxazole-5-carboxylate.
What is the SMILES notation for 3-methylbutyl 1,2-oxazole-5-carboxylate?
The canonical SMILES for 3-methylbutyl 1,2-oxazole-5-carboxylate is CC(C)CCOC(=O)c1ccno1.
What is the InChIKey of 3-methylbutyl 1,2-oxazole-5-carboxylate?
The InChIKey is IDSSPOOKUDFSSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-7(2)4-6-12-9(11)8-3-5-10-13-8/h3,5,7H,4,6H2,1-2H3.
What are the key properties of 3-methylbutyl 1,2-oxazole-5-carboxylate?
3-methylbutyl 1,2-oxazole-5-carboxylate has a molecular weight of 183.21 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 1,2-oxazole-5-carboxylate is sourced from PubChem (CID 164887837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).