C10H15N3O4 — CID 106419792
methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate (PubChem CID 106419792) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate.
| Compound Name | methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 106419792 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate |
| SMILES | COC(=O)C(CNCc1ccno1)NC(C)=O |
| InChI | InChI=1S/C10H15N3O4/c1-7(14)13-9(10(15)16-2)6-11-5-8-3-4-12-17-8/h3-4,9,11H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | WZOHVYDBYLDJRW-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |