methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate

C10H15N3O4 — CID 106419792

IUPACmethyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate
SMILESCOC(=O)C(CNCc1ccno1)NC(C)=O
InChIInChI=1S/C10H15N3O4/c1-7(14)13-9(10(15)16-2)6-11-5-8-3-4-12-17-8/h3-4,9,11H,5-6H2,1-2H3,(H,13,14)
InChIKeyWZOHVYDBYLDJRW-UHFFFAOYSA-N
MW241.25 g/mol
LogP-0.56
Rot. Bonds6

About methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate

methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate (PubChem CID 106419792) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate.

Molecular Properties

Compound Namemethyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate
PubChem CID106419792
Molecular FormulaC10H15N3O4
Molecular Weight241.25 g/mol
Exact Mass241.11
IUPAC Namemethyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate
SMILESCOC(=O)C(CNCc1ccno1)NC(C)=O
InChIInChI=1S/C10H15N3O4/c1-7(14)13-9(10(15)16-2)6-11-5-8-3-4-12-17-8/h3-4,9,11H,5-6H2,1-2H3,(H,13,14)
InChIKeyWZOHVYDBYLDJRW-UHFFFAOYSA-N
XLogP-0.56
TPSA93.46 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 5-0.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate?
The IUPAC name of methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate (CID 106419792) is methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate.
What is the SMILES notation for methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate?
The canonical SMILES for methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate is COC(=O)C(CNCc1ccno1)NC(C)=O.
What is the InChIKey of methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate?
The InChIKey is WZOHVYDBYLDJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4/c1-7(14)13-9(10(15)16-2)6-11-5-8-3-4-12-17-8/h3-4,9,11H,5-6H2,1-2H3,(H,13,14).
What are the key properties of methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate?
methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate has a molecular weight of 241.25 g/mol, XLogP of -0.56, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-(1,2-oxazol-5-ylmethylamino)propanoate is sourced from PubChem (CID 106419792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).