C11H16N2O4 — CID 103267901
methyl 2-acetamido-3-(furan-3-ylmethylamino)propanoate (PubChem CID 103267901) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl 2-acetamido-3-(furan-3-ylmethylamino)propanoate.
| Compound Name | methyl 2-acetamido-3-(furan-3-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 103267901 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl 2-acetamido-3-(furan-3-ylmethylamino)propanoate |
| SMILES | COC(=O)C(CNCc1ccoc1)NC(C)=O |
| InChI | InChI=1S/C11H16N2O4/c1-8(14)13-10(11(15)16-2)6-12-5-9-3-4-17-7-9/h3-4,7,10,12H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | CASAUDDKTDGUBX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |