C8H13NO — CID 89185800
2-amino-1-cyclohexa-1,3-dien-1-ylethanol (PubChem CID 89185800) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 2-amino-1-cyclohexa-1,3-dien-1-ylethanol.
| Compound Name | 2-amino-1-cyclohexa-1,3-dien-1-ylethanol |
|---|---|
| PubChem CID | 89185800 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 2-amino-1-cyclohexa-1,3-dien-1-ylethanol |
| SMILES | NCC(O)C1=CC=CCC1 |
| InChI | InChI=1S/C8H13NO/c9-6-8(10)7-4-2-1-3-5-7/h1-2,4,8,10H,3,5-6,9H2 |
| InChIKey | YZHBSPUXBRIGMX-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |