C12H14BBrN2O — CID 89186217
CID 89186217 (PubChem CID 89186217) has the molecular formula C12H14BBrN2O and a molecular weight of 292.97 g/mol.
| Compound Name | CID 89186217 |
|---|---|
| PubChem CID | 89186217 |
| Molecular Formula | C12H14BBrN2O |
| Molecular Weight | 292.97 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | — |
| SMILES | [B]N1CCCC(C(=O)Nc2ccccc2Br)C1 |
| InChI | InChI=1S/C12H14BBrN2O/c13-16-7-3-4-9(8-16)12(17)15-11-6-2-1-5-10(11)14/h1-2,5-6,9H,3-4,7-8H2,(H,15,17) |
| InChIKey | KQMOKUXHRFEMOB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.97 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|