C22H18N2O4 — CID 8918639
N-(9,10-dioxoanthracen-1-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide (PubChem CID 8918639) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-1-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide.
| Compound Name | N-(9,10-dioxoanthracen-1-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 8918639 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(9,10-dioxoanthracen-1-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]acetamide |
| SMILES | C[C@@H](NCC(=O)Nc1cccc2c1C(=O)c1ccccc1C2=O)c1ccco1 |
| InChI | InChI=1S/C22H18N2O4/c1-13(18-10-5-11-28-18)23-12-19(25)24-17-9-4-8-16-20(17)22(27)15-7-3-2-6-14(15)21(16)26/h2-11,13,23H,12H2,1H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | FKTZFSMTWJEAHD-CYBMUJFWSA-N |
| XLogP | 3.34 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|