About zinc;ethane;fluorobenzene
zinc;ethane;fluorobenzene (PubChem CID 89188895) has the molecular formula C8H9FZn
and a molecular weight of 189.55 g/mol. Its IUPAC name is zinc;ethane;fluorobenzene.
Molecular Properties
| Compound Name | zinc;ethane;fluorobenzene |
| PubChem CID | 89188895 |
| Molecular Formula | C8H9FZn |
| Molecular Weight | 189.55 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | zinc;ethane;fluorobenzene |
| SMILES | Fc1cc[c-]cc1.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C6H4F.C2H5.Zn/c7-6-4-2-1-3-5-6;1-2;/h2-5H;1H2,2H3;/q2*-1;+2 |
| InChIKey | JQEOOFGLUDJVLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;ethane;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;ethane;fluorobenzene?
The IUPAC name of zinc;ethane;fluorobenzene (CID 89188895) is zinc;ethane;fluorobenzene.
What is the SMILES notation for zinc;ethane;fluorobenzene?
The canonical SMILES for zinc;ethane;fluorobenzene is Fc1cc[c-]cc1.[CH2-]C.[Zn+2].
What is the InChIKey of zinc;ethane;fluorobenzene?
The InChIKey is JQEOOFGLUDJVLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F.C2H5.Zn/c7-6-4-2-1-3-5-6;1-2;/h2-5H;1H2,2H3;/q2*-1;+2.
What are the key properties of zinc;ethane;fluorobenzene?
zinc;ethane;fluorobenzene has a molecular weight of 189.55 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;ethane;fluorobenzene is sourced from PubChem (CID 89188895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).