C18H24N12O8 — CID 89189281
(3S,4R,5R)-2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-purin-3-yl]oxyamino]-5-(6-aminopurin-9-yl)-1,2-oxazolidine-3,4-diol (PubChem CID 89189281) has the molecular formula C18H24N12O8 and a molecular weight of 536.47 g/mol. Its IUPAC name is (3S,4R,5R)-2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-purin-3-yl]oxyamino]-5-(6-aminopurin-9-yl)-1,2-oxazolidine-3,4-diol.
| Compound Name | (3S,4R,5R)-2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-purin-3-yl]oxyamino]-5-(6-aminopurin-9-yl)-1,2-oxazolidine-3,4-diol |
|---|---|
| PubChem CID | 89189281 |
| Molecular Formula | C18H24N12O8 |
| Molecular Weight | 536.47 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | (3S,4R,5R)-2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-purin-3-yl]oxyamino]-5-(6-aminopurin-9-yl)-1,2-oxazolidine-3,4-diol |
| SMILES | NC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2N(ONN2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)C=N1 |
| InChI | InChI=1S/C18H24N12O8/c19-12-7-14(22-2-21-12)27(3-23-7)18-11(34)16(35)30(37-18)26-38-29-5-25-13(20)8-15(29)28(4-24-8)17-10(33)9(32)6(1-31)36-17/h2-6,9-11,15-18,26,31-35H,1,20H2,(H2,19,21,22)/t6-,9-,10-,11-,15?,16+,17-,18-/m1/s1 |
| InChIKey | WLEBDUHCJYOPLO-HZOOCPBCSA-N |
| XLogP | -5.23 |
| TPSA | 270.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.47 |
| LogP ≤ 5 | -5.23 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|