C4H10N2OS — CID 89189912
2-ethyl-1,2,5-thiadiazolidine 1-oxide (PubChem CID 89189912) has the molecular formula C4H10N2OS and a molecular weight of 134.20 g/mol. Its IUPAC name is 2-ethyl-1,2,5-thiadiazolidine 1-oxide.
| Compound Name | 2-ethyl-1,2,5-thiadiazolidine 1-oxide |
|---|---|
| PubChem CID | 89189912 |
| Molecular Formula | C4H10N2OS |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 2-ethyl-1,2,5-thiadiazolidine 1-oxide |
| SMILES | CCN1CCNS1=O |
| InChI | InChI=1S/C4H10N2OS/c1-2-6-4-3-5-8(6)7/h5H,2-4H2,1H3 |
| InChIKey | DCPYAHUMVZAOIO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |