C3H8N2OS — CID 23516050
2-methyl-1,2,5-thiadiazolidine 1-oxide (PubChem CID 23516050) has the molecular formula C3H8N2OS and a molecular weight of 120.18 g/mol. Its IUPAC name is 2-methyl-1,2,5-thiadiazolidine 1-oxide.
| Compound Name | 2-methyl-1,2,5-thiadiazolidine 1-oxide |
|---|---|
| PubChem CID | 23516050 |
| Molecular Formula | C3H8N2OS |
| Molecular Weight | 120.18 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 2-methyl-1,2,5-thiadiazolidine 1-oxide |
| SMILES | CN1CCNS1=O |
| InChI | InChI=1S/C3H8N2OS/c1-5-3-2-4-7(5)6/h4H,2-3H2,1H3 |
| InChIKey | LSPQMGOYMAAXJU-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.18 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |