C28H31FN2O3 — CID 89191600
3-fluoro-4-(3-hydroxybut-3-enyl)-N'-[1-[3-(methoxymethyl)-4-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]ethenoxy]benzenecarboximidamide (PubChem CID 89191600) has the molecular formula C28H31FN2O3 and a molecular weight of 462.57 g/mol. Its IUPAC name is 3-fluoro-4-(3-hydroxybut-3-enyl)-N'-[1-[3-(methoxymethyl)-4-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]ethenoxy]benzenecarboximidamide.
| Compound Name | 3-fluoro-4-(3-hydroxybut-3-enyl)-N'-[1-[3-(methoxymethyl)-4-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]ethenoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 89191600 |
| Molecular Formula | C28H31FN2O3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 3-fluoro-4-(3-hydroxybut-3-enyl)-N'-[1-[3-(methoxymethyl)-4-(2-methylphenyl)cyclohexa-2,4-dien-1-yl]ethenoxy]benzenecarboximidamide |
| SMILES | C=C(O)CCc1ccc(/C(N)=N/OC(=C)C2C=C(COC)C(c3ccccc3C)=CC2)cc1F |
| InChI | InChI=1S/C28H31FN2O3/c1-18-7-5-6-8-25(18)26-14-13-22(15-24(26)17-33-4)20(3)34-31-28(30)23-12-11-21(27(29)16-23)10-9-19(2)32/h5-8,11-12,14-16,22,32H,2-3,9-10,13,17H2,1,4H3,(H2,30,31) |
| InChIKey | UBNLPBZKXBDOBI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|