C10H17NO — CID 89192479
1-[(4S)-1-ethenyl-4-ethylpyrrolidin-2-yl]ethanone (PubChem CID 89192479) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-[(4S)-1-ethenyl-4-ethylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(4S)-1-ethenyl-4-ethylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 89192479 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-[(4S)-1-ethenyl-4-ethylpyrrolidin-2-yl]ethanone |
| SMILES | C=CN1C[C@@H](CC)CC1C(C)=O |
| InChI | InChI=1S/C10H17NO/c1-4-9-6-10(8(3)12)11(5-2)7-9/h5,9-10H,2,4,6-7H2,1,3H3/t9-,10?/m0/s1 |
| InChIKey | MCWPNKQGIURROL-RGURZIINSA-N |
| XLogP | 1.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |