C9H15NO — CID 157025794
1-[(2S,4R)-4-ethenyl-1-methylpyrrolidin-2-yl]ethanone (PubChem CID 157025794) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 1-[(2S,4R)-4-ethenyl-1-methylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2S,4R)-4-ethenyl-1-methylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 157025794 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-[(2S,4R)-4-ethenyl-1-methylpyrrolidin-2-yl]ethanone |
| SMILES | C=C[C@H]1C[C@@H](C(C)=O)N(C)C1 |
| InChI | InChI=1S/C9H15NO/c1-4-8-5-9(7(2)11)10(3)6-8/h4,8-9H,1,5-6H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | PIBAUEFYXOBRQZ-IUCAKERBSA-N |
| XLogP | 1.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|