C16H29BO2 — CID 89192820
2-[(2Z,4Z)-6-ethylocta-2,4-dien-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 89192820) has the molecular formula C16H29BO2 and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-[(2Z,4Z)-6-ethylocta-2,4-dien-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2Z,4Z)-6-ethylocta-2,4-dien-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 89192820 |
| Molecular Formula | C16H29BO2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | 2-[(2Z,4Z)-6-ethylocta-2,4-dien-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C=C(\C=C/C(CC)CC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H29BO2/c1-8-13(9-2)11-12-14(10-3)17-18-15(4,5)16(6,7)19-17/h10-13H,8-9H2,1-7H3/b12-11-,14-10+ |
| InChIKey | ZCRNGQVWBSCKPB-QOBSPMRMSA-N |
| XLogP | 4.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|