C10H16N2O — CID 89193638
(2E,4Z)-5-amino-2-ethenyl-N-ethyl-4-methylpenta-2,4-dienamide (PubChem CID 89193638) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is (2E,4Z)-5-amino-2-ethenyl-N-ethyl-4-methylpenta-2,4-dienamide.
| Compound Name | (2E,4Z)-5-amino-2-ethenyl-N-ethyl-4-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 89193638 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | (2E,4Z)-5-amino-2-ethenyl-N-ethyl-4-methylpenta-2,4-dienamide |
| SMILES | C=C/C(=C\C(C)=C/N)C(=O)NCC |
| InChI | InChI=1S/C10H16N2O/c1-4-9(6-8(3)7-11)10(13)12-5-2/h4,6-7H,1,5,11H2,2-3H3,(H,12,13)/b8-7-,9-6+ |
| InChIKey | MYHVUNKBISILLG-SOKJVCRVSA-N |
| XLogP | 1.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|