C27H40N2O9 — CID 89193903
8-ethoxy-N-[(2S)-3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 89193903) has the molecular formula C27H40N2O9 and a molecular weight of 536.62 g/mol. Its IUPAC name is 8-ethoxy-N-[(2S)-3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 8-ethoxy-N-[(2S)-3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 89193903 |
| Molecular Formula | C27H40N2O9 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 8-ethoxy-N-[(2S)-3-hydroxy-1-[[1-[2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]-6,7-dimethoxy-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | CCOc1c2c(cc(OC)c1OC)CCC(C(=O)N[C@@H](CO)C(=O)NC(CC(C)C)C(=O)C1(CO)CO1)C2 |
| InChI | InChI=1S/C27H40N2O9/c1-6-37-22-18-10-17(8-7-16(18)11-21(35-4)23(22)36-5)25(33)29-20(12-30)26(34)28-19(9-15(2)3)24(32)27(13-31)14-38-27/h11,15,17,19-20,30-31H,6-10,12-14H2,1-5H3,(H,28,34)(H,29,33)/t17?,19?,20-,27?/m0/s1 |
| InChIKey | CKPAJKAEFWOMST-TZWRADKKSA-N |
| XLogP | 0.55 |
| TPSA | 155.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|