About 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal
2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal (PubChem CID 89194004) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal.
Molecular Properties
| Compound Name | 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal |
| PubChem CID | 89194004 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal |
| SMILES | C=CC(=C)N(C)C(=C)C=O |
| InChI | InChI=1S/C8H11NO/c1-5-7(2)9(4)8(3)6-10/h5-6H,1-3H2,4H3 |
| InChIKey | ADWPKSHKGWGVPK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal?
The IUPAC name of 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal (CID 89194004) is 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal.
What is the SMILES notation for 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal?
The canonical SMILES for 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal is C=CC(=C)N(C)C(=C)C=O.
What is the InChIKey of 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal?
The InChIKey is ADWPKSHKGWGVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-5-7(2)9(4)8(3)6-10/h5-6H,1-3H2,4H3.
What are the key properties of 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal?
2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal has a molecular weight of 137.18 g/mol, XLogP of 1.33, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[buta-1,3-dien-2-yl(methyl)amino]prop-2-enal is sourced from PubChem (CID 89194004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).