C9H7F6NO4 — CID 89194244
ethyl 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylate (PubChem CID 89194244) has the molecular formula C9H7F6NO4 and a molecular weight of 307.15 g/mol. Its IUPAC name is ethyl 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 89194244 |
| Molecular Formula | C9H7F6NO4 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | ethyl 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(O)(C(F)(F)F)C(F)(F)F)on1 |
| InChI | InChI=1S/C9H7F6NO4/c1-2-19-6(17)4-3-5(20-16-4)7(18,8(10,11)12)9(13,14)15/h3,18H,2H2,1H3 |
| InChIKey | YVNBAUYFXHBXKH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |