C7H3F6NO4 — CID 89194243
5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 89194243) has the molecular formula C7H3F6NO4 and a molecular weight of 279.09 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 89194243 |
| Molecular Formula | C7H3F6NO4 |
| Molecular Weight | 279.09 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C(O)(C(F)(F)F)C(F)(F)F)on1 |
| InChI | InChI=1S/C7H3F6NO4/c8-6(9,10)5(17,7(11,12)13)3-1-2(4(15)16)14-18-3/h1,17H,(H,15,16) |
| InChIKey | QPEIFUWBRTZTOO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.09 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |