C15H18N2O6S2 — CID 89199510
ethyl (Z)-3-amino-2-[1-[(3-methylsulfonyloxybenzoyl)amino]ethenylsulfanyl]prop-2-enoate (PubChem CID 89199510) has the molecular formula C15H18N2O6S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl (Z)-3-amino-2-[1-[(3-methylsulfonyloxybenzoyl)amino]ethenylsulfanyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-amino-2-[1-[(3-methylsulfonyloxybenzoyl)amino]ethenylsulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 89199510 |
| Molecular Formula | C15H18N2O6S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | ethyl (Z)-3-amino-2-[1-[(3-methylsulfonyloxybenzoyl)amino]ethenylsulfanyl]prop-2-enoate |
| SMILES | C=C(NC(=O)c1cccc(OS(C)(=O)=O)c1)S/C(=C\N)C(=O)OCC |
| InChI | InChI=1S/C15H18N2O6S2/c1-4-22-15(19)13(9-16)24-10(2)17-14(18)11-6-5-7-12(8-11)23-25(3,20)21/h5-9H,2,4,16H2,1,3H3,(H,17,18)/b13-9- |
| InChIKey | HSRBGOCQNDBKGX-LCYFTJDESA-N |
| XLogP | 1.32 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|