C6H12O6 — CID 892
cyclohexane-1,2,3,4,5,6-hexol (PubChem CID 892) has the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. Its IUPAC name is cyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | cyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 892 |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | cyclohexane-1,2,3,4,5,6-hexol |
| SMILES | OC1C(O)C(O)C(O)C(O)C1O |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H |
| InChIKey | CDAISMWEOUEBRE-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |