C21H20ClN5O3 — CID 89200398
N-[4-(6-amino-8-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide (PubChem CID 89200398) has the molecular formula C21H20ClN5O3 and a molecular weight of 425.88 g/mol. Its IUPAC name is N-[4-(6-amino-8-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[4-(6-amino-8-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 89200398 |
| Molecular Formula | C21H20ClN5O3 |
| Molecular Weight | 425.88 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[4-(6-amino-8-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]-4-nitro-1H-pyrrole-2-carboxamide |
| SMILES | CN1Cc2c(Cl)cc(N)cc2C(c2ccc(NC(=O)c3cc([N+](=O)[O-])c[nH]3)cc2)C1 |
| InChI | InChI=1S/C21H20ClN5O3/c1-26-10-17(16-6-13(23)7-19(22)18(16)11-26)12-2-4-14(5-3-12)25-21(28)20-8-15(9-24-20)27(29)30/h2-9,17,24H,10-11,23H2,1H3,(H,25,28) |
| InChIKey | VSSHSZGELQNOTK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 117.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|