C40H58O — CID 89200831
(2S)-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,23-undecaenyl]-1-methyl-1-propan-2-yloxycyclopentane (PubChem CID 89200831) has the molecular formula C40H58O and a molecular weight of 554.90 g/mol. Its IUPAC name is (2S)-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,23-undecaenyl]-1-methyl-1-propan-2-yloxycyclopentane.
| Compound Name | (2S)-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,23-undecaenyl]-1-methyl-1-propan-2-yloxycyclopentane |
|---|---|
| PubChem CID | 89200831 |
| Molecular Formula | C40H58O |
| Molecular Weight | 554.90 g/mol |
| Exact Mass | 554.45 |
| IUPAC Name | (2S)-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E,19E)-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,23-undecaenyl]-1-methyl-1-propan-2-yloxycyclopentane |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/[C@@H]1CCCC1(C)OC(C)C |
| InChI | InChI=1S/C40H58O/c1-32(2)18-13-21-36(7)24-15-26-37(8)25-14-22-34(5)19-11-12-20-35(6)23-16-27-38(9)29-30-39-28-17-31-40(39,10)41-33(3)4/h11-12,14-16,18-20,22-27,29-30,33,39H,13,17,21,28,31H2,1-10H3/b12-11+,22-14+,23-16+,26-15+,30-29+,34-19+,35-20+,36-24+,37-25+,38-27+/t39-,40?/m0/s1 |
| InChIKey | FXFFLLJPFBSKLN-VBGFZZDSSA-N |
| XLogP | 12.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.90 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|