C28H34FN5O6 — CID 89200893
(2S)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-1,4-dimorpholin-4-ylbutane-1,4-dione (PubChem CID 89200893) has the molecular formula C28H34FN5O6 and a molecular weight of 555.61 g/mol. Its IUPAC name is (2S)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-1,4-dimorpholin-4-ylbutane-1,4-dione.
| Compound Name | (2S)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-1,4-dimorpholin-4-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 89200893 |
| Molecular Formula | C28H34FN5O6 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | (2S)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-1,4-dimorpholin-4-ylbutane-1,4-dione |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1CON[C@@H](CC(=O)N1CCOCC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C28H34FN5O6/c1-17-22(18(2)30-24(17)14-21-20-13-19(29)3-4-23(20)31-27(21)36)16-40-32-25(28(37)34-7-11-39-12-8-34)15-26(35)33-5-9-38-10-6-33/h3-4,13-14,25,30,32H,5-12,15-16H2,1-2H3,(H,31,36)/b21-14-/t25-/m0/s1 |
| InChIKey | YTXYRKVJIDDZJC-TYYSXUNWSA-N |
| XLogP | 1.76 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|