C23H27FN4O5 — CID 89200892
(2S)-5-(dimethylamino)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-5-oxopentanoic acid (PubChem CID 89200892) has the molecular formula C23H27FN4O5 and a molecular weight of 458.49 g/mol. Its IUPAC name is (2S)-5-(dimethylamino)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-(dimethylamino)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 89200892 |
| Molecular Formula | C23H27FN4O5 |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (2S)-5-(dimethylamino)-2-[[5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrol-3-yl]methoxyamino]-5-oxopentanoic acid |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(F)cc32)c(C)c1CON[C@@H](CCC(=O)N(C)C)C(=O)O |
| InChI | InChI=1S/C23H27FN4O5/c1-12-17(11-33-27-19(23(31)32)7-8-21(29)28(3)4)13(2)25-20(12)10-16-15-9-14(24)5-6-18(15)26-22(16)30/h5-6,9-10,19,25,27H,7-8,11H2,1-4H3,(H,26,30)(H,31,32)/b16-10-/t19-/m0/s1 |
| InChIKey | ZXYFWOWRGVOHQR-LZOLKVDOSA-N |
| XLogP | 2.61 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|