C13H26O2Si — CID 89201213
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dideuteriohept-6-enal (PubChem CID 89201213) has the molecular formula C13H26O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dideuteriohept-6-enal.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dideuteriohept-6-enal |
|---|---|
| PubChem CID | 89201213 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dideuteriohept-6-enal |
| SMILES | [2H]C([2H])(C=O)[C@H](CCC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-7-8-9-12(10-11-14)15-16(5,6)13(2,3)4/h7,11-12H,1,8-10H2,2-6H3/t12-/m0/s1/i10D2 |
| InChIKey | DKXLROCLCAEMKO-WAOSSSALSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|