C13H25IO2Si — CID 59051220
(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-methylhex-5-enal (PubChem CID 59051220) has the molecular formula C13H25IO2Si and a molecular weight of 368.33 g/mol. Its IUPAC name is (E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-methylhex-5-enal.
| Compound Name | (E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-methylhex-5-enal |
|---|---|
| PubChem CID | 59051220 |
| Molecular Formula | C13H25IO2Si |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | (E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-methylhex-5-enal |
| SMILES | C/C(=C\I)C[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25IO2Si/c1-11(10-14)9-12(7-8-15)16-17(5,6)13(2,3)4/h8,10,12H,7,9H2,1-6H3/b11-10+/t12-/m0/s1 |
| InChIKey | BOIFXBGUCHPJMD-IIANPFDCSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|