C27H28O7 — CID 89202436
(2,4-dimethoxyphenyl)-[2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]methanone (PubChem CID 89202436) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-[2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]methanone.
| Compound Name | (2,4-dimethoxyphenyl)-[2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]methanone |
|---|---|
| PubChem CID | 89202436 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (2,4-dimethoxyphenyl)-[2-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-4,6-dimethoxyphenyl]methanone |
| SMILES | COc1cc(/C=C/c2cc(OC)cc(OC)c2C(=O)c2ccc(OC)cc2OC)cc(OC)c1 |
| InChI | InChI=1S/C27H28O7/c1-29-19-9-10-23(24(15-19)33-5)27(28)26-18(13-22(32-4)16-25(26)34-6)8-7-17-11-20(30-2)14-21(12-17)31-3/h7-16H,1-6H3/b8-7+ |
| InChIKey | CTAXMWNSUUPYAC-BQYQJAHWSA-N |
| XLogP | 5.14 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|