C27H30FIN2O6 — CID 89202701
6-[(2-fluoro-3-iodo-5-morpholin-4-ylphenyl)methyl]-1-[(2S)-1-hydroxy-4-methoxybutan-2-yl]-7-methoxy-4-oxoquinoline-3-carbaldehyde (PubChem CID 89202701) has the molecular formula C27H30FIN2O6 and a molecular weight of 624.45 g/mol. Its IUPAC name is 6-[(2-fluoro-3-iodo-5-morpholin-4-ylphenyl)methyl]-1-[(2S)-1-hydroxy-4-methoxybutan-2-yl]-7-methoxy-4-oxoquinoline-3-carbaldehyde.
| Compound Name | 6-[(2-fluoro-3-iodo-5-morpholin-4-ylphenyl)methyl]-1-[(2S)-1-hydroxy-4-methoxybutan-2-yl]-7-methoxy-4-oxoquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 89202701 |
| Molecular Formula | C27H30FIN2O6 |
| Molecular Weight | 624.45 g/mol |
| Exact Mass | 624.11 |
| IUPAC Name | 6-[(2-fluoro-3-iodo-5-morpholin-4-ylphenyl)methyl]-1-[(2S)-1-hydroxy-4-methoxybutan-2-yl]-7-methoxy-4-oxoquinoline-3-carbaldehyde |
| SMILES | COCC[C@@H](CO)n1cc(C=O)c(=O)c2cc(Cc3cc(N4CCOCC4)cc(I)c3F)c(OC)cc21 |
| InChI | InChI=1S/C27H30FIN2O6/c1-35-6-3-20(16-33)31-14-19(15-32)27(34)22-11-17(25(36-2)13-24(22)31)9-18-10-21(12-23(29)26(18)28)30-4-7-37-8-5-30/h10-15,20,33H,3-9,16H2,1-2H3/t20-/m0/s1 |
| InChIKey | AYKQKMWSTXYRIL-FQEVSTJZSA-N |
| XLogP | 3.56 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|