C38H50O6 — CID 89202986
2-[[(3S,6aR,8aS,11S,12aR,14bS)-11-formyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxycarbonyl]benzoic acid (PubChem CID 89202986) has the molecular formula C38H50O6 and a molecular weight of 602.81 g/mol. Its IUPAC name is 2-[[(3S,6aR,8aS,11S,12aR,14bS)-11-formyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxycarbonyl]benzoic acid.
| Compound Name | 2-[[(3S,6aR,8aS,11S,12aR,14bS)-11-formyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 89202986 |
| Molecular Formula | C38H50O6 |
| Molecular Weight | 602.81 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | 2-[[(3S,6aR,8aS,11S,12aR,14bS)-11-formyl-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxycarbonyl]benzoic acid |
| SMILES | CC1(C)C2CC[C@]3(C)C(C(=O)C=C4[C@@H]5C[C@@](C)(C=O)CC[C@]5(C)CCC43C)[C@@]2(C)CC[C@@H]1OC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C38H50O6/c1-33(2)28-12-15-38(7)30(36(28,5)14-13-29(33)44-32(43)24-11-9-8-10-23(24)31(41)42)27(40)20-25-26-21-34(3,22-39)16-17-35(26,4)18-19-37(25,38)6/h8-11,20,22,26,28-30H,12-19,21H2,1-7H3,(H,41,42)/t26-,28?,29-,30?,34-,35+,36-,37?,38+/m0/s1 |
| InChIKey | ZWSXCKOXLDACQV-XCKAFRDSSA-N |
| XLogP | 8.09 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.81 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|