C38H53NO4 — CID 94855502
[(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(phenylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate (PubChem CID 94855502) has the molecular formula C38H53NO4 and a molecular weight of 587.85 g/mol. Its IUPAC name is [(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(phenylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(phenylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 94855502 |
| Molecular Formula | C38H53NO4 |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 587.40 |
| IUPAC Name | [(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bR)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(phenylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H](CC[C@]3(C)[C@@H]2C(=O)C=C2[C@H]4C[C@@](C)(C(=O)Nc5ccccc5)CC[C@]4(C)CC[C@@]23C)C1(C)C |
| InChI | InChI=1S/C38H53NO4/c1-24(40)43-30-15-16-36(6)29(33(30,2)3)14-17-38(8)31(36)28(41)22-26-27-23-35(5,32(42)39-25-12-10-9-11-13-25)19-18-34(27,4)20-21-37(26,38)7/h9-13,22,27,29-31H,14-21,23H2,1-8H3,(H,39,42)/t27-,29-,30+,31-,34-,35+,36-,37+,38-/m1/s1 |
| InChIKey | HLIGTICNBKYEOH-RXBNCCETSA-N |
| XLogP | 8.54 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |