C38H53NO5 — CID 94855483
[(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bS)-11-[(2-hydroxyphenyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate (PubChem CID 94855483) has the molecular formula C38H53NO5 and a molecular weight of 603.84 g/mol. Its IUPAC name is [(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bS)-11-[(2-hydroxyphenyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bS)-11-[(2-hydroxyphenyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 94855483 |
| Molecular Formula | C38H53NO5 |
| Molecular Weight | 603.84 g/mol |
| Exact Mass | 603.39 |
| IUPAC Name | [(3S,4aS,6aR,6bR,8aS,11S,12aS,14aR,14bS)-11-[(2-hydroxyphenyl)carbamoyl]-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@H](CC[C@]3(C)[C@@H]2C(=O)C=C2[C@H]4C[C@@](C)(C(=O)Nc5ccccc5O)CC[C@]4(C)CC[C@@]23C)C1(C)C |
| InChI | InChI=1S/C38H53NO5/c1-23(40)44-30-14-15-36(6)29(33(30,2)3)13-16-38(8)31(36)28(42)21-24-25-22-35(5,18-17-34(25,4)19-20-37(24,38)7)32(43)39-26-11-9-10-12-27(26)41/h9-12,21,25,29-31,41H,13-20,22H2,1-8H3,(H,39,43)/t25-,29-,30+,31-,34-,35+,36+,37+,38-/m1/s1 |
| InChIKey | SJQHYONQODYEPY-OKAJSGPWSA-N |
| XLogP | 8.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.84 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|