About CID 89207227
CID 89207227 (PubChem CID 89207227) has the molecular formula C8H5BN2O
and a molecular weight of 155.95 g/mol.
Molecular Properties
| Compound Name | CID 89207227 |
| PubChem CID | 89207227 |
| Molecular Formula | C8H5BN2O |
| Molecular Weight | 155.95 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | — |
| SMILES | [B]c1nc(C=O)c2ccccn12 |
| InChI | InChI=1S/C8H5BN2O/c9-8-10-6(5-12)7-3-1-2-4-11(7)8/h1-5H |
| InChIKey | NRIDQUPXLQDCCK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.95 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89207227 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89207227?
The IUPAC name of CID 89207227 (CID 89207227) is not available.
What is the SMILES notation for CID 89207227?
The canonical SMILES for CID 89207227 is [B]c1nc(C=O)c2ccccn12.
What is the InChIKey of CID 89207227?
The InChIKey is NRIDQUPXLQDCCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BN2O/c9-8-10-6(5-12)7-3-1-2-4-11(7)8/h1-5H.
What are the key properties of CID 89207227?
CID 89207227 has a molecular weight of 155.95 g/mol, XLogP of -0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89207227 is sourced from PubChem (CID 89207227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).