C12H8N2OS — CID 957617
3-thiophen-2-ylimidazo[1,5-a]pyridine-1-carbaldehyde (PubChem CID 957617) has the molecular formula C12H8N2OS and a molecular weight of 228.28 g/mol. Its IUPAC name is 3-thiophen-2-ylimidazo[1,5-a]pyridine-1-carbaldehyde.
| Compound Name | 3-thiophen-2-ylimidazo[1,5-a]pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 957617 |
| Molecular Formula | C12H8N2OS |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 3-thiophen-2-ylimidazo[1,5-a]pyridine-1-carbaldehyde |
| SMILES | O=Cc1nc(-c2cccs2)n2ccccc12 |
| InChI | InChI=1S/C12H8N2OS/c15-8-9-10-4-1-2-6-14(10)12(13-9)11-5-3-7-16-11/h1-8H |
| InChIKey | QBMIPXXTUOFQGU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|