C12H15BN2O2S — CID 89209993
CID 89209993 (PubChem CID 89209993) has the molecular formula C12H15BN2O2S and a molecular weight of 262.14 g/mol.
| Compound Name | CID 89209993 |
|---|---|
| PubChem CID | 89209993 |
| Molecular Formula | C12H15BN2O2S |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | — |
| SMILES | [B]C1CCC(NS(=O)(=O)c2ccc(C)cc2)=NC1 |
| InChI | InChI=1S/C12H15BN2O2S/c1-9-2-5-11(6-3-9)18(16,17)15-12-7-4-10(13)8-14-12/h2-3,5-6,10H,4,7-8H2,1H3,(H,14,15) |
| InChIKey | JJJZRTCXZHXAGZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|