C19H20N4S — CID 89210579
5-isoquinolin-6-yl-N-[[(1R)-2-methylidenecyclohexyl]methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 89210579) has the molecular formula C19H20N4S and a molecular weight of 336.46 g/mol. Its IUPAC name is 5-isoquinolin-6-yl-N-[[(1R)-2-methylidenecyclohexyl]methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-isoquinolin-6-yl-N-[[(1R)-2-methylidenecyclohexyl]methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 89210579 |
| Molecular Formula | C19H20N4S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 5-isoquinolin-6-yl-N-[[(1R)-2-methylidenecyclohexyl]methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | C=C1CCCC[C@H]1CNc1nnc(-c2ccc3cnccc3c2)s1 |
| InChI | InChI=1S/C19H20N4S/c1-13-4-2-3-5-16(13)12-21-19-23-22-18(24-19)15-6-7-17-11-20-9-8-14(17)10-15/h6-11,16H,1-5,12H2,(H,21,23)/t16-/m0/s1 |
| InChIKey | IALJLOIXPRVBNP-INIZCTEOSA-N |
| XLogP | 4.91 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|